cas: 2239312-26-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(((1R,3R,E)-5-(2-((1R,3aS,7aR,E)-7a-Methyl-1-((R)-6-methylheptan-2-yl)octahydro-4H-inden-4-ylidene)ethylidene)-4-methylenecyclohexane-1,3-diyl)bis(oxy))bis(tert-butyldimethylsilane), 98% (CAS 2239312-26-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 25mg, 10mg. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch138IGH-1mg |
| cas | 2239312-26-4 |
| opakowanie | 1mg |
| dostępność | 2.4g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 1096,40 Pln | |
| Chemat | 5mg | 3165,20 Pln | |
| Chemat | 25mg | 10398,80 Pln | |
| Fluorochem | 1mg | 1242,29 Pln | |
| Fluorochem | 5mg | 3543,56 Pln | |
| Fluorochem | 10mg | 5870,87 Pln | |
| Fluorochem | 25mg | 11462,65 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
[(1R,3E,5R)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane (CAS 2239312-26-4) to związek chemiczny o wzorze sumarycznym C39H72O2Si2 i masie molowej 629.2 g/mol. Nazwa systematyczna IUPAC: [(1R,3E,5R)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane. InChIKey: YYGPOUVOBLNWHS-RNVVARTMSA-N.
| Wzór sumaryczny | C39H72O2Si2 |
|---|---|
| Masa molowa | 629.2 g/mol |
| Nazwa IUPAC | [(1R,3E,5R)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane |
| InChIKey | YYGPOUVOBLNWHS-RNVVARTMSA-N |
| SMILES | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C\3/C[C@H](C[C@H](C3=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C |
Dane obliczone przez PubChem (NCBI)