(1E,4E)-1,5-Bis(4-(trifluoromethyl)phenyl)penta-1,4-dien-3-one, 98%
cas: 103836-71-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(1E,4E)-1,5-Bis(4-(trifluoromethyl)phenyl)penta-1,4-dien-3-one, 98% (CAS 103836-71-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A589057-100mg |
| cas | 103836-71-1 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 248,00 Pln | |
| Ambeed | 250mg | 392,62 Pln | |
| Ambeed | 1g | 1015,62 Pln | |
| Ambeed | 5g | 3079,31 Pln | |
| BLDpharm | 100mg | 264,38 Pln | |
| BLDpharm | 250mg | 419,88 Pln | |
| BLDpharm | 1g | 1091,86 Pln | |
| BLDpharm | 5g | 3318,86 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
(1E,4E)-1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-one (CAS 103836-71-1) to związek chemiczny o wzorze sumarycznym C19H12F6O i masie molowej 370.3 g/mol. Nazwa systematyczna IUPAC: (1E,4E)-1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-one. InChIKey: OIUBVYQZMUKRRF-YDWXAUTNSA-N.
| Wzór sumaryczny | C19H12F6O |
|---|---|
| Masa molowa | 370.3 g/mol |
| Nazwa IUPAC | (1E,4E)-1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-one |
| InChIKey | OIUBVYQZMUKRRF-YDWXAUTNSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)/C=C/C2=CC=C(C=C2)C(F)(F)F)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(1E,4E)-1,5-Bis[4-(trifluoromethyl)phenyl]-1,4-pentadien-3-one, (1E,4E)-1,5-Bis(4-(trifluoromethyl)phenyl)-1,4-pentadien-3-one, Trans,trans-1,5-Bis[4-(trifluoromethyl)phenyl]-1,4-pentadien-3-one, (1E,4E)-1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-one, (1E,4E)-1,5-Bis(4-(trifluoromethyl)phenyl)penta-1,4-dien-3-one, 1,5-bis(4-(trifluoromethyl)phenyl)penta-1,4-dien-3-one, 1,5-Bis[4-(trifluoromethyl)phenyl]-1,4-pentadien-3-one, trans,trans-Bis[4-(trifluoromethyl)benzal]acetone, 1,5-Bis(4-trifluoromethylphenyl)-penta-1,4-diene-3-one, 1,5-Bis[4-trifluoromethylphenyl]-1,4-pentadiene-3-one