(1R,2R)-Dimethyl Cyclohexane-1,2-Dicarboxylate, ≥97%
cas: 140459-96-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(1R,2R)-Dimethyl Cyclohexane-1,2-Dicarboxylate, ≥97% (CAS 140459-96-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112CHN-100mg |
| cas | 140459-96-7 |
| opakowanie | 100mg |
| dostępność | 125g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 323,60 Pln | |
| Chemat | 250mg | 496,40 Pln | |
| Chemat | 1g | 890,00 Pln | |
| Chemat | 5g | 2541,20 Pln | |
| Chemat | 10g | 3990,80 Pln | |
| Chemat | 25g | 8992,40 Pln |
właściwości
| czystość | ≥97% |
|---|---|
| czas dostawy | 3 tygodnie |
Trans-dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate (CAS 140459-96-7) to związek chemiczny o wzorze sumarycznym C10H16O4 i masie molowej 200.23 g/mol. Nazwa systematyczna IUPAC: trans-dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate. InChIKey: AIACXWOETVLBIA-HTQZYQBOSA-N.
| Wzór sumaryczny | C10H16O4 |
|---|---|
| Masa molowa | 200.23 g/mol |
| Nazwa IUPAC | trans-dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate |
| InChIKey | AIACXWOETVLBIA-HTQZYQBOSA-N |
| SMILES | COC(=O)[C@@H]1CCCC[C@H]1C(=O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
trans-1,2-Cyclohexanedicarboxylic Acid Dimethyl Ester, rel-1,2-Dimethyl (1R,2R)-1,2-cyclohexanedicarboxylate, (1R,2R)-Dimethyl cyclohexane-1,2-dicarboxylate, dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate, trans-Dimethyl cyclohexane-1,2-dicarboxylate, Dimethyl trans-1,2-Cyclohexanedicarboxylate, (1R,2R)1,2-Cyclohexanedicarboxylic Acid 1,2-Dimethyl Ester, 1,2-Cyclohexanedicarboxylic acid, 1,2-dimethyl ester, (1R,2R)-, rel-Dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate, 1,2-Dimethyl (1R,2R)-1,2-cyclohexanedicarboxylate