(1S,2S)-(-)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine, 95%
cas: 60508-97-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(1S,2S)-(-)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine, 95% (CAS 60508-97-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Combi-blocks.
| producent | Combi-blocks |
|---|---|
| nr katalogowy | QH-2464-100mg |
| cas | 60508-97-6 |
| opakowanie | 100mg |
Dokumenty:
Karta charakterystyki (MSDS)
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Combi-blocks | 100mg | cena na żądanie | |
| Combi-blocks | 250mg | cena na żądanie | |
| Combi-blocks | 1g | cena na żądanie |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie, tylko jeżeli na stocku, by sprawdzić kliknij dostępność |
(1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine (CAS 60508-97-6) to związek chemiczny o wzorze sumarycznym C16H20N2 i masie molowej 240.34 g/mol. Nazwa systematyczna IUPAC: (1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine. InChIKey: BTHYVQUNQHWNLS-HOTGVXAUSA-N.
| Wzór sumaryczny | C16H20N2 |
|---|---|
| Masa molowa | 240.34 g/mol |
| Nazwa IUPAC | (1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine |
| InChIKey | BTHYVQUNQHWNLS-HOTGVXAUSA-N |
| SMILES | CN[C@@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)NC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diaminium, (1S,2S)-N,N'-Dimethyl-1,2-diphenylethane-1,2-diamine, (1S,2S)-N1,N2-Dimethyl-1,2-diphenylethane-1,2-diamine, (1S,2S)-N,N'-Dimethyl-1,2-diphenylethylenediamine, (1S,2S)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethanediamine, rel-(1S,2S)-N,N'-Dimethyl-1,2-diphenylethane-1,2-diamine, (1S,2S)-N,N'-dimethyl-1,2-diphenyl-ethane-1,2-diamine, 1,2-Ethanediamine, N,N'-dimethyl-1,2-diphenyl-, (1S,2S)-, [(1S,2S)-2-(methylamino)-1,2-diphenylethyl]methylamine, (1S,2S)-N~1~,N~2~-Dimethyl-1,2-diphenylethane-1,2-diamine