(1S,2S)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine, 97%, 97%
cas: 58520-04-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(1S,2S)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine, 97%, 97% (CAS 58520-04-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11IAEF-100mg |
| cas | 58520-04-0 |
| opakowanie | 100mg |
| dostępność | 125g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 83,60 Pln | |
| Chemat | 250mg | 93,20 Pln | |
| Chemat | 1g | 98,00 Pln | |
| Chemat | 5g | 242,00 Pln | |
| Chemat | 10g | 419,60 Pln | |
| Chemat | 25g | 952,40 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
(1R,2R)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine (CAS 58520-04-0) to związek chemiczny o wzorze sumarycznym C16H20N2O2 i masie molowej 272.34 g/mol. Nazwa systematyczna IUPAC: (1R,2R)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine. InChIKey: ZWMPRHYHRAUVGY-HZPDHXFCSA-N.
| Wzór sumaryczny | C16H20N2O2 |
|---|---|
| Masa molowa | 272.34 g/mol |
| Nazwa IUPAC | (1R,2R)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine |
| InChIKey | ZWMPRHYHRAUVGY-HZPDHXFCSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]([C@@H](C2=CC=C(C=C2)OC)N)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(1R,2R)-1,2-Bis(4-methoxyphenyl)ethylenediamine, meso-1,2-Bis(4-methoxyphenyl)ethylenediamine, (1R,2R)-1,2-Di(4'-methoxyphenyl)-1,2-diaminoethane, (1R,2R)-1,2-Di(4-methoxyphenyl)-1,2-diaminoethane, (1R,2R)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine, 1,2-Ethanediamine, 1,2-bis(4-methoxyphenyl)-, (1R,2R)-, (1R,2R)-Bis(4-methoxyphenyl)-1,2-ethanediamine, (1S,2S)-Bis(4-methoxyphenyl)-1,2-ethanediamine, (1r,2r)-1,2-di(4-methoxylphenyl)ethylenediamine, (1s,2s)-1,2-bis(4-methoxyphenyl)ethylenediamine