cas: 14534-61-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(1S,3R,4R,5R)-3,4-Bis[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-1,5-dihydroxycyclohexanecarboxylic acid, 98%, 98% (CAS 14534-61-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112KU4-1mg |
| cas | 14534-61-3 |
| opakowanie | 1mg |
| dostępność | 1.25g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 122,00 Pln | |
| Chemat | 5mg | 198,80 Pln | |
| Chemat | 10mg | 280,40 Pln | |
| Chemat | 25mg | 472,40 Pln | |
| Chemat | 50mg | 683,60 Pln | |
| Chemat | 100mg | 990,80 Pln | |
| Chemat | 250mg | 1998,80 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(1R,3R,4S,5R)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1,5-dihydroxycyclohexane-1-carboxylic acid (CAS 14534-61-3) to związek chemiczny o wzorze sumarycznym C25H24O12 i masie molowej 516.4 g/mol. Nazwa systematyczna IUPAC: (1R,3R,4S,5R)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1,5-dihydroxycyclohexane-1-carboxylic acid. InChIKey: UFCLZKMFXSILNL-RVXRWRFUSA-N.
| Wzór sumaryczny | C25H24O12 |
|---|---|
| Masa molowa | 516.4 g/mol |
| Nazwa IUPAC | (1R,3R,4S,5R)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1,5-dihydroxycyclohexane-1-carboxylic acid |
| InChIKey | UFCLZKMFXSILNL-RVXRWRFUSA-N |
| SMILES | C1[C@H]([C@@H]([C@@H](C[C@]1(C(=O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)OC(=O)/C=C/C3=CC(=C(C=C3)O)O)O |
Dane obliczone przez PubChem (NCBI)