(1s,4s)-4-(trifluoromethoxy)cyclohexane-1-carboxylic acid, 97%, 97%
cas: 2231666-24-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(1s,4s)-4-(trifluoromethoxy)cyclohexane-1-carboxylic acid, 97%, 97% (CAS 2231666-24-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12X0VV-100mg |
| cas | 2231666-24-1 |
| opakowanie | 100mg |
| dostępność | 1g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 1811,60 Pln | |
| Chemat | 250mg | 2867,60 Pln | |
| Chemat | 500mg | 4730,00 Pln | |
| Chemat | 1g | 7067,60 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
4-(trifluoromethoxy)cyclohexane-1-carboxylic acid (CAS 2231666-24-1) to związek chemiczny o wzorze sumarycznym C8H11F3O3 i masie molowej 212.17 g/mol. Nazwa systematyczna IUPAC: 4-(trifluoromethoxy)cyclohexane-1-carboxylic acid. InChIKey: QGMWMYHMLLIPMI-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H11F3O3 |
|---|---|
| Masa molowa | 212.17 g/mol |
| Nazwa IUPAC | 4-(trifluoromethoxy)cyclohexane-1-carboxylic acid |
| InChIKey | QGMWMYHMLLIPMI-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)OC(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-(trifluoromethoxy)cyclohexane-1-carboxylic acid, 4-(Trifluoromethoxy)cyclohexanecarboxylic acid, cis-4-(Trifluoromethoxy)cyclohexanecarboxylic acid, trans-4-(trifluoromethoxy)cyclohexanecarboxylic acid, 4-(trifluoromethoxy)cyclohexanecarboxylic acid (cis/trans), trans-4-(trifluoromethoxy)cyclohexane-1-carboxylic acid, 4-(trifluoromethoxy)cyclohexanecarboxylic acid (cis/trans), (1s,4s)-4-(trifluoromethoxy)cyclohexane-1-carboxylic acid, (1r,4r)-4-(trifluoromethoxy)cyclohexane-1-carboxylic acid, cis-4-(Trifluoromethoxy)cyclohexanecarboxylicacid