(2'-chloro-[1，1'-biphenyl]-2-yl)boronic acid, 98%
cas: 2209082-58-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(2'-chloro-[1，1'-biphenyl]-2-yl)boronic acid, 98% (CAS 2209082-58-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12XAR1-250mg |
| cas | 2209082-58-4 |
| opakowanie | 250mg |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 117,20 Pln | |
| Chemat | 1g | 136,40 Pln | |
| Chemat | 5g | 362,00 Pln | |
| Chemat | 10g | 650,00 Pln | |
| Chemat | 25g | 1259,60 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
[2-(2-chlorophenyl)phenyl]boronic acid (CAS 2209082-58-4) to związek chemiczny o wzorze sumarycznym C12H10BClO2 i masie molowej 232.47 g/mol. Nazwa systematyczna IUPAC: [2-(2-chlorophenyl)phenyl]boronic acid. InChIKey: OMHVPCSULWQQQQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H10BClO2 |
|---|---|
| Masa molowa | 232.47 g/mol |
| Nazwa IUPAC | [2-(2-chlorophenyl)phenyl]boronic acid |
| InChIKey | OMHVPCSULWQQQQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=CC=CC=C2Cl)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(2'-chloro-[1,1'-biphenyl]-2-yl)boronic acid, (2'-Chloro-[1,1'-biphenyl]-2-yl)boronicacid, [2'-chloro-(1,1'-biphenyl)-2-yl]boronic acid, [2-(2-chlorophenyl)phenyl]boronic acid, Boronic acid, B-(2'-chloro[1,1'-biphenyl]-2-yl)-, {2'-chloro-[1,1'-biphenyl]-2-yl}boronic acid, 2-(2-Chlorophenyl)phenyl]boronic acid, (2-chloro-[1,1'-biphenyl]-2 -yl)boronicacid, B-(2'-Chloro[1,1'-biphenyl]-2-yl)boronic acid, (2'- chloro - [1,1'- biphenyl] -2-yl) boric acid