(2-(Naphthalen-2-yl)phenyl)boronic acid, 95%, 95%
cas: 1061350-97-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(2-(Naphthalen-2-yl)phenyl)boronic acid, 95%, 95% (CAS 1061350-97-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11031A-100mg |
| cas | 1061350-97-7 |
| opakowanie | 100mg |
| dostępność | 10g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 160,40 Pln | |
| Chemat | 250mg | 208,40 Pln | |
| Chemat | 1g | 386,00 Pln | |
| Chemat | 5g | 1437,20 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
(2-naphthalen-2-ylphenyl)boronic acid (CAS 1061350-97-7) to związek chemiczny o wzorze sumarycznym C16H13BO2 i masie molowej 248.1 g/mol. Nazwa systematyczna IUPAC: (2-naphthalen-2-ylphenyl)boronic acid. InChIKey: UKGHMNPNPCSUIG-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H13BO2 |
|---|---|
| Masa molowa | 248.1 g/mol |
| Nazwa IUPAC | (2-naphthalen-2-ylphenyl)boronic acid |
| InChIKey | UKGHMNPNPCSUIG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=CC3=CC=CC=C3C=C2)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(2-(Naphthalen-2-yl)phenyl)boronic acid, (2-naphthalen-2-ylphenyl)boronic acid, 2-(2-Naphthyl)phenylboronic acid, 2-(naphthalen-2-yl)phenylboronic acid, [2-(Naphthalen-2-yl)phenyl]boronic acid, 2-(2-Naphthyl)benzeneboronic acid, [2-(2-Naphthyl)phenyl]boronic acid, 2-(2-Naphthalenyl)phenylboronicacid,, (2-(Naphthalen-2-yl)phenyl)boronic acid;2-(2-naphthalenyl)phenylboronic acid, (2-(Naphthalen-2-yl)phenyl)boronicacid