(2-Cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)methanol, 97%
cas: 121660-11-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(2-Cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)methanol, 97% (CAS 121660-11-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A144722-100mg |
| cas | 121660-11-5 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 125,62 Pln | |
| Ambeed | 250mg | 131,19 Pln | |
| Ambeed | 1g | 147,88 Pln | |
| Ambeed | 5g | 175,69 Pln | |
| Ambeed | 10g | 275,81 Pln | |
| Ambeed | 25g | 442,69 Pln | |
| Ambeed | 100g | 887,69 Pln | |
| Chemat | 100mg | 74,00 Pln | |
| Chemat | 1g | 78,80 Pln | |
| Chemat | 5g | 136,40 Pln | |
| Chemat | 10g | 189,20 Pln | |
| Chemat | 25g | 347,60 Pln | |
| Chemat | 100g | 669,20 Pln | |
| Chemat | 500g | 1910,40 Pln | |
| BLDpharm | 100mg | 125,54 Pln | |
| BLDpharm | 250mg | 136,64 Pln | |
| BLDpharm | 1g | 153,30 Pln | |
| BLDpharm | 5g | 186,63 Pln | |
| BLDpharm | 10g | 292,14 Pln | |
| BLDpharm | 25g | 469,86 Pln | |
| BLDpharm | 100g | 947,47 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie |
[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methanol (CAS 121660-11-5) to związek chemiczny o wzorze sumarycznym C19H16FNO i masie molowej 293.3 g/mol. Nazwa systematyczna IUPAC: [2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methanol. InChIKey: FIZDBNPUFMDGFZ-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H16FNO |
|---|---|
| Masa molowa | 293.3 g/mol |
| Nazwa IUPAC | [2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methanol |
| InChIKey | FIZDBNPUFMDGFZ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C(=C2CO)C4=CC=C(C=C4)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(2-Cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)methanol, [2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methanol, 2-Cyclopropyl-4-(4-fluorophenyl)-quinolyl-3-methanol, 2-Cyclopropyl-4-(4-fluorophenyl)-3-quinolinemethanol, 3-Quinolinemethanol, 2-cyclopropyl-4-(4-fluorophenyl)-, Pitavastatin Impurity 46, 2-Cyclopropyl-4-(4'-fluorophenyl) Quinolyl-3-methanol, (2-cyclopropyl-4-(4-fluorophenyl)quinoline-3-yl)methanol, FIZDBNPUFMDGFZ-UHFFFAOYSA-N, Pitavastatin Hydroxymethyl Impurity