(2R,5S)-rel-Diethyl 2,5-dibromohexanedioate, 98%
cas: 54221-37-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(2R,5S)-rel-Diethyl 2,5-dibromohexanedioate, 98% (CAS 54221-37-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 25g, 100g, 500g, 1kg. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A855502-5g |
| cas | 54221-37-3 |
| opakowanie | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 5g | 170,12 Pln | |
| Ambeed | 25g | 331,44 Pln | |
| Ambeed | 100g | 476,06 Pln | |
| Ambeed | 500g | 1738,75 Pln | |
| Ambeed | 1kg | 2906,88 Pln | |
| BLDpharm | 5g | 147,75 Pln | |
| BLDpharm | 25g | 325,47 Pln | |
| BLDpharm | 100g | 469,86 Pln | |
| BLDpharm | 500g | 1702,76 Pln | |
| BLDpharm | 1kg | 2846,80 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
Diethyl (2S,5R)-2,5-dibromohexanedioate (CAS 54221-37-3) to związek chemiczny o wzorze sumarycznym C10H16Br2O4 i masie molowej 360.04 g/mol. Nazwa systematyczna IUPAC: diethyl (2S,5R)-2,5-dibromohexanedioate. InChIKey: UBCNJHBDCUBIPB-OCAPTIKFSA-N.
| Wzór sumaryczny | C10H16Br2O4 |
|---|---|
| Masa molowa | 360.04 g/mol |
| Nazwa IUPAC | diethyl (2S,5R)-2,5-dibromohexanedioate |
| InChIKey | UBCNJHBDCUBIPB-OCAPTIKFSA-N |
| SMILES | CCOC(=O)[C@@H](CC[C@@H](C(=O)OCC)Br)Br |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Diethyl meso-2,5-dibromoadipate, (2R,5S)-rel-Diethyl 2,5-dibromohexanedioate, Diethyl (2R,5S)-2,5-dibromohexanedioate, diethyl (2S,5R)-2,5-dibromohexanedioate, (2R,5S)-rel-Diethyl2,5-dibromohexanedioate, (2S,5R)-Dibromo-hexanedioic acid diethyl ester, 2,5-dibromo-2,3-diethylhexanedioate, Diethyl meso-2,5-dibromoadipate, 98%, 2,5-bis(bromanyl)-2,3-diethyl-hexanedioate