cas: 461432-25-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(2R,3R,4R,5S,6S)-2-(Acetoxymethyl)-6-(4-chloro-3-(4-ethoxybenzyl)phenyl)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 98%, 98% (CAS 461432-25-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch117XCX-500g |
| cas | 461432-25-7 |
| opakowanie | 500g |
| dostępność | 2500g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 500g | 8376,00 Pln | |
| Chemat | 100mg | 88,40 Pln | |
| Chemat | 250mg | 98,00 Pln | |
| Chemat | 1g | 126,80 Pln | |
| Chemat | 5g | 256,40 Pln | |
| Chemat | 10g | 419,60 Pln | |
| Chemat | 25g | 837,20 Pln | |
| Chemat | 100g | 2037,20 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]oxan-2-yl]methyl acetate (CAS 461432-25-7) to związek chemiczny o wzorze sumarycznym C29H33ClO10 i masie molowej 577.0 g/mol. Nazwa systematyczna IUPAC: [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]oxan-2-yl]methyl acetate. InChIKey: DKOQYKRDCDCNOR-ZCCUTQAASA-N.
| Wzór sumaryczny | C29H33ClO10 |
|---|---|
| Masa molowa | 577.0 g/mol |
| Nazwa IUPAC | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]oxan-2-yl]methyl acetate |
| InChIKey | DKOQYKRDCDCNOR-ZCCUTQAASA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)Cl |
Dane obliczone przez PubChem (NCBI)