cas: 1542275-16-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[[N-(4-methoxy-2,3,6-trimethyl-phenyl)sulfonylcarbamimidoyl]amino]-2-methyl-pentanoic acid, 97%, 97% (CAS 1542275-16-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch134JMV-100mg |
| cas | 1542275-16-0 |
| opakowanie | 100mg |
| dostępność | 1g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 1398,80 Pln | |
| Chemat | 250mg | 2738,00 Pln | |
| Chemat | 500mg | 4518,80 Pln | |
| Chemat | 1g | 7490,00 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpentanoic acid (CAS 1542275-16-0) to związek chemiczny o wzorze sumarycznym C32H38N4O7S i masie molowej 622.7 g/mol. Nazwa systematyczna IUPAC: (2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpentanoic acid. InChIKey: RNMKLRGFBIFXCJ-YTTGMZPUSA-N.
| Wzór sumaryczny | C32H38N4O7S |
|---|---|
| Masa molowa | 622.7 g/mol |
| Nazwa IUPAC | (2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpentanoic acid |
| InChIKey | RNMKLRGFBIFXCJ-YTTGMZPUSA-N |
| SMILES | CC1=CC(=C(C(=C1S(=O)(=O)NC(=NCCC[C@@](C)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)N)C)C)OC |
Dane obliczone przez PubChem (NCBI)