(3-(Naphthalen-1-yl)phenyl)boronic acid, 96%, 96%
cas: 881913-20-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(3-(Naphthalen-1-yl)phenyl)boronic acid, 96%, 96% (CAS 881913-20-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119BJ5-250mg |
| cas | 881913-20-8 |
| opakowanie | 250mg |
| dostępność | 9g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 69,20 Pln | |
| Chemat | 1g | 93,20 Pln | |
| Chemat | 5g | 179,60 Pln |
właściwości
| czystość | 96% |
|---|---|
| czas dostawy | 3 tygodnie |
(3-naphthalen-1-ylphenyl)boronic acid (CAS 881913-20-8) to związek chemiczny o wzorze sumarycznym C16H13BO2 i masie molowej 248.1 g/mol. Nazwa systematyczna IUPAC: (3-naphthalen-1-ylphenyl)boronic acid. InChIKey: HFXYUCJLQZCNPD-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H13BO2 |
|---|---|
| Masa molowa | 248.1 g/mol |
| Nazwa IUPAC | (3-naphthalen-1-ylphenyl)boronic acid |
| InChIKey | HFXYUCJLQZCNPD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC=CC3=CC=CC=C32)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride), (3-(Naphthalen-1-yl)phenyl)boronic acid, 3-(1-naphthyl)phenylboronic acid, (3-Naphthalen-1-ylphenyl)boronic acid, [3-(1-Naphthyl)phenyl]boronic acid, [3-(Naphthalen-1-yl)phenyl]boronic acid, (3-(Naphthalen-1-yl)phenyl)boronic acid;3-(1-naphthalenyl)phenylboronic acid, 3-(1-Naphthyl)benzeneboronic acid, HFXYUCJLQZCNPD-UHFFFAOYSA-N, 3-(1-naphthyl) phenylboronic acid