(3-(Naphthalen-2-yl)phenyl)boronic acid, 98%
cas: 870774-29-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(3-(Naphthalen-2-yl)phenyl)boronic acid, 98% (CAS 870774-29-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 250mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A247675-1g |
| cas | 870774-29-1 |
| opakowanie | 1g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1g | 170,12 Pln | |
| Ambeed | 5g | 520,56 Pln | |
| Ambeed | 10g | 965,56 Pln | |
| Ambeed | 25g | 2133,69 Pln | |
| Chemat | 250mg | 83,60 Pln | |
| Chemat | 1g | 122,00 Pln | |
| Chemat | 5g | 352,40 Pln | |
| BLDpharm | 250mg | 169,96 Pln | |
| BLDpharm | 1g | 197,73 Pln | |
| BLDpharm | 5g | 553,16 Pln | |
| BLDpharm | 25g | 2296,99 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
(3-naphthalen-2-ylphenyl)boronic acid (CAS 870774-29-1) to związek chemiczny o wzorze sumarycznym C16H13BO2 i masie molowej 248.1 g/mol. Nazwa systematyczna IUPAC: (3-naphthalen-2-ylphenyl)boronic acid. InChIKey: WLKQDOGZCIYEOM-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H13BO2 |
|---|---|
| Masa molowa | 248.1 g/mol |
| Nazwa IUPAC | (3-naphthalen-2-ylphenyl)boronic acid |
| InChIKey | WLKQDOGZCIYEOM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC3=CC=CC=C3C=C2)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3-(2-Naphthyl)phenylboronic acid, (3-(Naphthalen-2-yl)phenyl)boronic acid, 3-(naphthalene-2-yl)phenylboronic acid, (3-naphthalen-2-ylphenyl)boronic acid, 3-(2-Naphthyl)benzeneboronic acid, 3-(naphthalen-2-yl)phenylboronic acid, (3-(Naphthalen-2-yl)phenyl)boronicacid, [3-(Naphthalen-2-yl)phenyl]boronic acid, 3-(2-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride), Boronic acid, [3-(2-naphthalenyl)phenyl]-