cas: 1254118-35-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(3-(difluoroMethyl)-4-fluorophenyl)boronic acid, 96%, 96% (CAS 1254118-35-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch110YFY-100mg |
| cas | 1254118-35-8 |
| opakowanie | 100mg |
| dostępność | 2g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 299,60 Pln | |
| Chemat | 250mg | 506,00 Pln | |
| Chemat | 1g | 1053,20 Pln |
| czystość | 96% |
|---|---|
| czas dostawy | 3 tygodnie |
[3-(difluoromethyl)-4-fluorophenyl]boronic acid (CAS 1254118-35-8) to związek chemiczny o wzorze sumarycznym C7H6BF3O2 i masie molowej 189.93 g/mol. Nazwa systematyczna IUPAC: [3-(difluoromethyl)-4-fluorophenyl]boronic acid. InChIKey: SZVBSEHYKANIRO-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H6BF3O2 |
|---|---|
| Masa molowa | 189.93 g/mol |
| Nazwa IUPAC | [3-(difluoromethyl)-4-fluorophenyl]boronic acid |
| InChIKey | SZVBSEHYKANIRO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(F)F)(O)O |
Dane obliczone przez PubChem (NCBI)