cas: 1260612-08-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(3R,4R)-tert-Butyl 4-amino-3-fluoropiperidine-1-carboxylate, 98%, 98% (CAS 1260612-08-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 500mg, 100g, 250g, 500g, 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch111QW0-500mg |
| cas | 1260612-08-5 |
| opakowanie | 500mg |
| dostępność | 500g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 500mg | 256,40 Pln | |
| Chemat | 100g | 7067,60 Pln | |
| Chemat | 250g | 13346,00 Pln | |
| Chemat | 500g | 20798,40 Pln | |
| Chemat | 100mg | 126,80 Pln | |
| Chemat | 250mg | 165,20 Pln | |
| Chemat | 1g | 338,00 Pln | |
| Chemat | 5g | 890,00 Pln | |
| Chemat | 10g | 1576,40 Pln | |
| Chemat | 25g | 3165,20 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl (3R,4R)-4-amino-3-fluoropiperidine-1-carboxylate (CAS 1260612-08-5) to związek chemiczny o wzorze sumarycznym C10H19FN2O2 i masie molowej 218.27 g/mol. Nazwa systematyczna IUPAC: tert-butyl (3R,4R)-4-amino-3-fluoropiperidine-1-carboxylate. InChIKey: ZQRYPCAUVKVMLZ-HTQZYQBOSA-N.
| Wzór sumaryczny | C10H19FN2O2 |
|---|---|
| Masa molowa | 218.27 g/mol |
| Nazwa IUPAC | tert-butyl (3R,4R)-4-amino-3-fluoropiperidine-1-carboxylate |
| InChIKey | ZQRYPCAUVKVMLZ-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)F)N |
Dane obliczone przez PubChem (NCBI)