cas: 111594-58-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(3S)-1,3-Bis-O-(tert-Butyldimethylsilyl)-3-hydroxy-5,6-trans-vitamin D2, 98%, 98% (CAS 111594-58-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11IM4O-100mg |
| cas | 111594-58-2 |
| opakowanie | 100mg |
| dostępność | 26g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 376,40 Pln | |
| Chemat | 250mg | 582,80 Pln | |
| Chemat | 1g | 1106,00 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
[(1S,3E,5R)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane (CAS 111594-58-2) to związek chemiczny o wzorze sumarycznym C40H72O2Si2 i masie molowej 641.2 g/mol. Nazwa systematyczna IUPAC: [(1S,3E,5R)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane. InChIKey: UHCDRCBBCZLXBO-BTKCQVIHSA-N.
| Wzór sumaryczny | C40H72O2Si2 |
|---|---|
| Masa molowa | 641.2 g/mol |
| Nazwa IUPAC | [(1S,3E,5R)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane |
| InChIKey | UHCDRCBBCZLXBO-BTKCQVIHSA-N |
| SMILES | C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C\3/C[C@H](C[C@@H](C3=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C |
Dane obliczone przez PubChem (NCBI)