cas: 1290191-73-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(3S,4R)-tert-Butyl 3-amino-4-fluoropiperidine-1-carboxylate, 97%, 97% (CAS 1290191-73-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10g, 25g, 50g, 50mg, 100mg, 250mg, 500mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch111YSD-10g |
| cas | 1290191-73-9 |
| opakowanie | 10g |
| dostępność | 50g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 10g | 7437,20 Pln | |
| Chemat | 25g | 14819,60 Pln | |
| Chemat | 50g | 25898,00 Pln | |
| Chemat | 50mg | 438,80 Pln | |
| Chemat | 100mg | 544,40 Pln | |
| Chemat | 250mg | 1029,20 Pln | |
| Chemat | 500mg | 1576,40 Pln | |
| Chemat | 1g | 2128,40 Pln | |
| Chemat | 5g | 6266,00 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl (3S,4R)-3-amino-4-fluoropiperidine-1-carboxylate (CAS 1290191-73-9) to związek chemiczny o wzorze sumarycznym C10H19FN2O2 i masie molowej 218.27 g/mol. Nazwa systematyczna IUPAC: tert-butyl (3S,4R)-3-amino-4-fluoropiperidine-1-carboxylate. InChIKey: CVHJEFDRBTZVEL-SFYZADRCSA-N.
| Wzór sumaryczny | C10H19FN2O2 |
|---|---|
| Masa molowa | 218.27 g/mol |
| Nazwa IUPAC | tert-butyl (3S,4R)-3-amino-4-fluoropiperidine-1-carboxylate |
| InChIKey | CVHJEFDRBTZVEL-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)N)F |
Dane obliczone przez PubChem (NCBI)