(4'-Ethyl-[1,1'-biphenyl]-4-yl)boronic acid, 97%, 97%
cas: 153035-62-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(4'-Ethyl-[1,1'-biphenyl]-4-yl)boronic acid, 97%, 97% (CAS 153035-62-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch118YAP-250mg |
| cas | 153035-62-2 |
| opakowanie | 250mg |
| dostępność | 75g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 78,80 Pln | |
| Chemat | 1g | 107,60 Pln | |
| Chemat | 5g | 194,00 Pln | |
| Chemat | 10g | 314,00 Pln | |
| Chemat | 25g | 621,20 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
[4-(4-ethylphenyl)phenyl]boronic acid (CAS 153035-62-2) to związek chemiczny o wzorze sumarycznym C14H15BO2 i masie molowej 226.08 g/mol. Nazwa systematyczna IUPAC: [4-(4-ethylphenyl)phenyl]boronic acid. InChIKey: DEUOTLGHQXNPJY-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H15BO2 |
|---|---|
| Masa molowa | 226.08 g/mol |
| Nazwa IUPAC | [4-(4-ethylphenyl)phenyl]boronic acid |
| InChIKey | DEUOTLGHQXNPJY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)CC)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
[4-(4-ethylphenyl)phenyl]boronic acid, 4/'-Ethyl-4-biphenylboronic acid, {4'-ethyl-[1,1'-biphenyl]-4-yl}boronic acid, 4`-Ethyl-4-biphenylboronic Acid, DEUOTLGHQXNPJY-UHFFFAOYSA-N, (4'-Ethyl[1,1'-biphenyl]-4-yl)boronic acid, 4 inverted exclamation mark -Ethyl-4-biphenylboronic Acid, 4'-Ethyl-4-biphenylboronic acid (contains varying amounts of Anhydride pound(c)