(4'-Nitro-[1,1'-biphenyl]-4-yl)methanol, ≥95%
cas: 62037-99-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(4'-Nitro-[1,1'-biphenyl]-4-yl)methanol, ≥95% (CAS 62037-99-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11ECWD-100mg |
| cas | 62037-99-4 |
| opakowanie | 100mg |
| dostępność | 15g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 1528,40 Pln | |
| Chemat | 250mg | 1782,80 Pln | |
| Chemat | 1g | 2747,60 Pln | |
| Chemat | 5g | 5507,60 Pln | |
| Fluorochem | 100mg | 2851,10 Pln | |
| Fluorochem | 250mg | 3293,65 Pln | |
| Fluorochem | 1g | 5089,89 Pln | |
| Fluorochem | 5g | 10041,27 Pln |
właściwości
| czystość | ≥95% |
|---|---|
| czas dostawy | 3 tygodnie |
[4-(4-nitrophenyl)phenyl]methanol (CAS 62037-99-4) to związek chemiczny o wzorze sumarycznym C13H11NO3 i masie molowej 229.23 g/mol. Nazwa systematyczna IUPAC: [4-(4-nitrophenyl)phenyl]methanol. InChIKey: MDUQVWINYYIMOQ-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H11NO3 |
|---|---|
| Masa molowa | 229.23 g/mol |
| Nazwa IUPAC | [4-(4-nitrophenyl)phenyl]methanol |
| InChIKey | MDUQVWINYYIMOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C2=CC=C(C=C2)[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(4'-nitro[1,1'-biphenyl]-4-yl)methanol, (4'-Nitro-[1,1'-biphenyl]-4-yl)methanol, [4-(4-nitrophenyl)phenyl]methanol, 4'-nitro-[1,1'-Biphenyl]-4-methanol, 4-(4-Nitrophenyl)benzyl alcohol, 4'-Nitrobiphenyl-4-methanol, {4'-nitro-[1,1'-biphenyl]-4-yl}methanol, 4-(4-Nitrophenylbenzyl alcohol, [4-(4-nitrophenyl)phenyl]methan-1-ol, 4 inverted exclamation mark -Nitrobiphenyl-4-methanol