(4'-Pentyl-[1,1'-biphenyl]-4-yl)boronic acid, 97%
cas: 121554-18-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(4'-Pentyl-[1,1'-biphenyl]-4-yl)boronic acid, 97% (CAS 121554-18-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11260U-250mg |
| cas | 121554-18-5 |
| opakowanie | 250mg |
| dostępność | 300g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 78,80 Pln | |
| Chemat | 1g | 83,60 Pln | |
| Chemat | 5g | 126,80 Pln | |
| Chemat | 25g | 381,20 Pln | |
| Chemat | 100g | 1298,00 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
[4-(4-pentylphenyl)phenyl]boronic acid (CAS 121554-18-5) to związek chemiczny o wzorze sumarycznym C17H21BO2 i masie molowej 268.2 g/mol. Nazwa systematyczna IUPAC: [4-(4-pentylphenyl)phenyl]boronic acid. InChIKey: QRZCEXCQSFQDMG-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H21BO2 |
|---|---|
| Masa molowa | 268.2 g/mol |
| Nazwa IUPAC | [4-(4-pentylphenyl)phenyl]boronic acid |
| InChIKey | QRZCEXCQSFQDMG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)CCCCC)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4'-Pentyl-4-biphenylboronic Acid (contains varying amounts of Anhydride), (4'-Pentyl-[1,1'-biphenyl]-4-yl)boronic acid, (4'-Pentyl[1,1'-biphenyl]-4-yl)boronic acid, [4-(4-pentylphenyl)phenyl]boronic acid, (4'-Pentyl[1,1'-biphenyl]-4-yl)-boronic acid, 4'-Pentyl-4-biphenylboronic acid, Boronic acid, B-(4'-pentyl[1,1'-biphenyl]-4-yl)-, {4'-pentyl-[1,1'-biphenyl]-4-yl}boronic acid, 4-(4-Pentylphenyl)benzeneboronic acid, (4/'-Pentyl[1,1/'-biphenyl]-4-yl)-boronic acid