(4-(10-Phenylanthracen-9-yl)phenyl)boronic acid, 95%
cas: 952604-30-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(4-(10-Phenylanthracen-9-yl)phenyl)boronic acid, 95% (CAS 952604-30-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12JJW9-100mg |
| cas | 952604-30-7 |
| opakowanie | 100mg |
| dostępność | 2g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 750,80 Pln | |
| Chemat | 250mg | 1096,40 Pln | |
| Chemat | 1g | 2128,40 Pln | |
| Fluorochem | 1g | 3934,05 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
[4-(10-phenylanthracen-9-yl)phenyl]boronic acid (CAS 952604-30-7) to związek chemiczny o wzorze sumarycznym C26H19BO2 i masie molowej 374.2 g/mol. Nazwa systematyczna IUPAC: [4-(10-phenylanthracen-9-yl)phenyl]boronic acid. InChIKey: YNDGEMZBYUVHTH-UHFFFAOYSA-N.
| Wzór sumaryczny | C26H19BO2 |
|---|---|
| Masa molowa | 374.2 g/mol |
| Nazwa IUPAC | [4-(10-phenylanthracen-9-yl)phenyl]boronic acid |
| InChIKey | YNDGEMZBYUVHTH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=CC=C5)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-(10-Phenylanthracen-9-yl)benzeneboronic acid, B-[4-(10-Phenyl-9-anthracenyl)phenyl]boronic acid, B-(4-(10-Phenyl-9-anthracenyl)phenyl)boronic acid, (4-(10-Phenylanthracen-9-yl)phenyl)boronic acid, [4-(10-phenylanthracen-9-yl)phenyl]boronic acid, B-[4-(10-phenyl-9-anthracenyl)phenyl]-boronic acid, starbld0017834, YNDGEMZBYUVHTH-UHFFFAOYSA-N, 4-(10-phenyl-9-anthryl)phenylboronic acid, [4-(10-phenyl-9-anthryl)phenyl]boronic acid