(4-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, 98+%
cas: 1199616-73-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(4-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, 98+% (CAS 1199616-73-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Ambeed, Chemat.
| producent | Ambeed |
|---|---|
| nr katalogowy | A491543-250mg |
| cas | 1199616-73-3 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 720,81 Pln | |
| Ambeed | 1g | 1772,12 Pln | |
| Ambeed | 5g | 6027,44 Pln | |
| Chemat | 100mg | 501,20 Pln | |
| Chemat | 250mg | 760,40 Pln | |
| Chemat | 1g | 1878,80 Pln |
właściwości
| czystość | 98+% |
|---|---|
| czas dostawy | 2-3 tygodnie |
(2-fluoro-5-phenylphenyl)boronic acid (CAS 1199616-73-3) to związek chemiczny o wzorze sumarycznym C12H10BFO2 i masie molowej 216.02 g/mol. Nazwa systematyczna IUPAC: (2-fluoro-5-phenylphenyl)boronic acid. InChIKey: FWNPBPIXFRESBL-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H10BFO2 |
|---|---|
| Masa molowa | 216.02 g/mol |
| Nazwa IUPAC | (2-fluoro-5-phenylphenyl)boronic acid |
| InChIKey | FWNPBPIXFRESBL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2=CC=CC=C2)F)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(4-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid, (2-fluoro-5-phenylphenyl)boronic acid, {4-fluoro-[1,1'-biphenyl]-3-yl}boronic acid, starbld0017807, Boronic acid, B-(4-fluoro[1,1'-biphenyl]-3-yl)-, (2-fluoro-5-phenyl-phenyl)boronic acid, (4-Fluoro[1,1'-biphenyl]-3-yl)boronic acid, (4-Fluoro-[1,1''-biphenyl]-3-yl)boronic acid, B-(4-Fluoro[1,1a(2)-biphenyl]-3-yl)boronic acid, Boronic acid, B-(4-fluoro[1,1?-biphenyl]-3-yl)-