(4-Methyl-3-nitrophenyl)boronic acid, 97%
cas: 80500-27-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(4-Methyl-3-nitrophenyl)boronic acid, 97% (CAS 80500-27-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 25g, 100g, 10g, 15g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119MG2-1g |
| cas | 80500-27-2 |
| opakowanie | 1g |
| dostępność | 200g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 78,80 Pln | |
| Chemat | 5g | 131,60 Pln | |
| Chemat | 25g | 405,20 Pln | |
| Chemat | 100g | 1384,40 Pln | |
| Fluorochem | 5g | 185,37 Pln | |
| Fluorochem | 10g | 263,47 Pln | |
| Fluorochem | 25g | 523,79 Pln | |
| Fluorochem | 100g | 1669,22 Pln | |
| Fluorochem | 15g | 362,39 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
(4-methyl-3-nitrophenyl)boronic acid (CAS 80500-27-2) to związek chemiczny o wzorze sumarycznym C7H8BNO4 i masie molowej 180.96 g/mol. Nazwa systematyczna IUPAC: (4-methyl-3-nitrophenyl)boronic acid. InChIKey: OASVXBRTNVFKFS-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H8BNO4 |
|---|---|
| Masa molowa | 180.96 g/mol |
| Nazwa IUPAC | (4-methyl-3-nitrophenyl)boronic acid |
| InChIKey | OASVXBRTNVFKFS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)[N+](=O)[O-])(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
4-Methyl-3-nitrophenylboronic acid, (4-methyl-3-nitrophenyl)boronic acid, 4-methyl-3-nitrophenyl boronic acid, (4-methyl-3-nitro-phenyl)-oxidanyl-oxidanylidene-boron, 3-Nitro-p-tolylboronic Acid, 4-Methyl-3-nitrophenylboronicacid, (4-methyl-3-nitro-phenyl)boronic Acid, Boronic acid, (4-methyl-3-nitrophenyl)-, 4-methyl-3-nitro-phenyl boronic acid