(5'-Formyl-[2,2'-bithiophen]-5-yl)boronic acid, 95%
cas: 1369328-62-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(5'-Formyl-[2,2'-bithiophen]-5-yl)boronic acid, 95% (CAS 1369328-62-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 1g, 250mg. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1154207-100mg |
| cas | 1369328-62-0 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 687,44 Pln | |
| Ambeed | 1g | 3702,31 Pln | |
| BLDpharm | 100mg | 747,54 Pln | |
| BLDpharm | 250mg | 1291,79 Pln | |
| BLDpharm | 1g | 4007,50 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
[5-(5-formylthiophen-2-yl)thiophen-2-yl]boronic acid (CAS 1369328-62-0) to związek chemiczny o wzorze sumarycznym C9H7BO3S2 i masie molowej 238.1 g/mol. Nazwa systematyczna IUPAC: [5-(5-formylthiophen-2-yl)thiophen-2-yl]boronic acid. InChIKey: RDIOTSOSMWVMSX-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H7BO3S2 |
|---|---|
| Masa molowa | 238.1 g/mol |
| Nazwa IUPAC | [5-(5-formylthiophen-2-yl)thiophen-2-yl]boronic acid |
| InChIKey | RDIOTSOSMWVMSX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)C2=CC=C(S2)C=O)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
5'-Formyl-2,2'-bithiophene-5-boronic Acid, 5-(5-Formyl-2-thienyl)-2-thiopheneboronic Acid, [5-(5-formylthiophen-2-yl)thiophen-2-yl]boronic acid, (5'-Formyl-[2,2'-bithiophen]-5-yl)boronic acid, (5'-Formyl-[2,2'-bithiophen]-5-yl)boronicacid, [5-(5-formyl-2-thienyl)-2-thienyl]boronic acid, B-(5'-Formyl[2,2'-bithiophen]-5-yl)boronic acid, 5'-Formyl-2,2'-bithiophene-5-boronic acid (contains varying amounts of anhyd, 5'-Formyl-2,2'-bithiophene-5-boronic Acid(contains varying amounts of Anhydride)