(5-Phenylthiophen-2-yl)boronic acid, 95%, 95%
cas: 306934-95-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(5-Phenylthiophen-2-yl)boronic acid, 95%, 95% (CAS 306934-95-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1141U5-100mg |
| cas | 306934-95-2 |
| opakowanie | 100mg |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 102,80 Pln | |
| Chemat | 250mg | 126,80 Pln | |
| Chemat | 1g | 232,40 Pln | |
| Chemat | 5g | 453,20 Pln | |
| Chemat | 25g | 1610,00 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
(5-phenylthiophen-2-yl)boronic acid (CAS 306934-95-2) to związek chemiczny o wzorze sumarycznym C10H9BO2S i masie molowej 204.06 g/mol. Nazwa systematyczna IUPAC: (5-phenylthiophen-2-yl)boronic acid. InChIKey: RBSMKSPHBJFXCJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H9BO2S |
|---|---|
| Masa molowa | 204.06 g/mol |
| Nazwa IUPAC | (5-phenylthiophen-2-yl)boronic acid |
| InChIKey | RBSMKSPHBJFXCJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)C2=CC=CC=C2)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(5-phenylthiophen-2-yl)boronic Acid, (5-Phenylthien-2-yl)boronic acid, 5-Phenylthiophene-2-boronic acid, Boronic acid, B-(5-phenyl-2-thienyl)-, 5-phenylthiophen-2-ylboronic acid, 5-Phenyl-2-thiopheneboronic acid, 5-phenyl-thiophen-2-boronic acid, RBSMKSPHBJFXCJ-UHFFFAOYSA-N, (5-phenyl-2-thienyl)boronic acid, (5-Phenylthiophen-2-yl)boronicacid