(E)-1,2-Bis(4-(trifluoromethyl)phenyl)ethene, 98%
cas: 42134-74-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(E)-1,2-Bis(4-(trifluoromethyl)phenyl)ethene, 98% (CAS 42134-74-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12XE9H-100mg |
| cas | 42134-74-7 |
| opakowanie | 100mg |
| dostępność | 300g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 88,40 Pln | |
| Chemat | 250mg | 112,40 Pln | |
| Chemat | 1g | 227,60 Pln | |
| Chemat | 5g | 813,20 Pln | |
| Chemat | 10g | 1538,00 Pln | |
| Chemat | 15g | 2210,00 Pln | |
| Chemat | 25g | 3390,80 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
1-(trifluoromethyl)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzene (CAS 42134-74-7) to związek chemiczny o wzorze sumarycznym C16H10F6 i masie molowej 316.24 g/mol. Nazwa systematyczna IUPAC: 1-(trifluoromethyl)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzene. InChIKey: AKPPHKDAEYUZPI-OWOJBTEDSA-N.
| Wzór sumaryczny | C16H10F6 |
|---|---|
| Masa molowa | 316.24 g/mol |
| Nazwa IUPAC | 1-(trifluoromethyl)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzene |
| InChIKey | AKPPHKDAEYUZPI-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)C(F)(F)F)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)