cas: 37308-75-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(E)-1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one, 98.00% ,, 98.00% , (CAS 37308-75-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11CH0B-1mg |
| cas | 37308-75-1 |
| opakowanie | 1mg |
| dostępność | 0.1g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 342,80 Pln | |
| Chemat | 2mg | 453,20 Pln | |
| Chemat | 5mg | 712,40 Pln | |
| Chemat | 10mg | 1106,00 Pln | |
| Chemat | 25mg | 1960,40 Pln | |
| Chemat | 50mg | 2886,80 Pln | |
| Chemat | 100mg | 4168,40 Pln |
| czystość | 98.00% , |
|---|---|
| czas dostawy | 3 tygodnie |
(E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one (CAS 37308-75-1) to związek chemiczny o wzorze sumarycznym C17H16O5 i masie molowej 300.30 g/mol. Nazwa systematyczna IUPAC: (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: UXUFMIJZNYXWDX-VMPITWQZSA-N.
| Wzór sumaryczny | C17H16O5 |
|---|---|
| Masa molowa | 300.30 g/mol |
| Nazwa IUPAC | (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | UXUFMIJZNYXWDX-VMPITWQZSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)/C=C/C2=CC=C(C=C2)O)O |
Dane obliczone przez PubChem (NCBI)