(E)-3-(5-Nitrothiophen-2-yl)acrylic acid, 97%, 97%
cas: 50868-70-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(E)-3-(5-Nitrothiophen-2-yl)acrylic acid, 97%, 97% (CAS 50868-70-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11DJUU-250mg |
| cas | 50868-70-7 |
| opakowanie | 250mg |
| dostępność | 30g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 203,60 Pln | |
| Chemat | 1g | 381,20 Pln | |
| Chemat | 5g | 1317,20 Pln | |
| Chemat | 100mg | 146,00 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
(E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid (CAS 50868-70-7) to związek chemiczny o wzorze sumarycznym C7H5NO4S i masie molowej 199.19 g/mol. Nazwa systematyczna IUPAC: (E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid. InChIKey: IIJCRPJUZLOCIE-DUXPYHPUSA-N.
| Wzór sumaryczny | C7H5NO4S |
|---|---|
| Masa molowa | 199.19 g/mol |
| Nazwa IUPAC | (E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid |
| InChIKey | IIJCRPJUZLOCIE-DUXPYHPUSA-N |
| SMILES | C1=C(SC(=C1)[N+](=O)[O-])/C=C/C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(2E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid, 3-(5-Nitrothiophen-2-yl)acrylic acid, (E)-3-(5-nitrothiophen-2-yl)acrylic acid, 3-(5-Nitro-2-thiophene)acrylic Acid, (E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid, (E)-3-(5-Nitro-2-thienyl)acrylic acid, (E)-3-(5-Nitrothien-2-yl)acrylic acid, (2E)-3-(5-nitrothiophen-2-yl)prop-2-enoicacid, (E)-3-(2-nitrothiophen-5-yl)propenoic acid, (E)-3-(5-nitrothiophen-2-yl)acrylicacid