cas: 83088-26-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(E)-4-(3,5-Dimethoxystyryl)-1,2-dimethoxybenzene, 99%, 99% (CAS 83088-26-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119JXO-100mg |
| cas | 83088-26-0 |
| opakowanie | 100mg |
| dostępność | 2g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 136,40 Pln | |
| Chemat | 250mg | 184,40 Pln | |
| Chemat | 1g | 232,40 Pln |
| czystość | 99% |
|---|---|
| czas dostawy | 3 tygodnie |
1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene (CAS 83088-26-0) to związek chemiczny o wzorze sumarycznym C18H20O4 i masie molowej 300.3 g/mol. Nazwa systematyczna IUPAC: 1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene. InChIKey: PTVAOGIYBMTHSN-AATRIKPKSA-N.
| Wzór sumaryczny | C18H20O4 |
|---|---|
| Masa molowa | 300.3 g/mol |
| Nazwa IUPAC | 1-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene |
| InChIKey | PTVAOGIYBMTHSN-AATRIKPKSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C2=CC(=CC(=C2)OC)OC)OC |
Dane obliczone przez PubChem (NCBI)