(R)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride, 95%, 95%
cas: 279227-92-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(R)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride, 95%, 95% (CAS 279227-92-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11BIO6-100mg |
| cas | 279227-92-8 |
| opakowanie | 100mg |
| dostępność | 10g |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 88,40 Pln | |
| Chemat | 250mg | 126,80 Pln | |
| Chemat | 1g | 314,00 Pln | |
| Chemat | 5g | 1317,20 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate;hydrochloride (CAS 279227-92-8) to związek chemiczny o wzorze sumarycznym C11H21ClN2O4 i masie molowej 280.75 g/mol. Nazwa systematyczna IUPAC: 1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate;hydrochloride. InChIKey: MESGHYLTRXYTHM-DDWIOCJRSA-N.
| Wzór sumaryczny | C11H21ClN2O4 |
|---|---|
| Masa molowa | 280.75 g/mol |
| Nazwa IUPAC | 1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate;hydrochloride |
| InChIKey | MESGHYLTRXYTHM-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@@H]1C(=O)OC.Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(R)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride, (R)-1-N-BOC-PIPERAZINE-2-CARBOXYLIC ACID METHYL ESTER-HCl, (r)-1-n-boc-piperazine-2-carboxylic acid methyl ester hydrochloride, 1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate;hydrochloride, MESGHYLTRXYTHM-DDWIOCJRSA-N, (R)-1-tert-Butyl2-methylpiperazine-1,2-dicarboxylatehydrochloride, Methyl (2R)-1-Boc-piperazine-2-carboxylate HCl, (R)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate HCl, O1-tert-butyl O2-methyl (2R)-piperazine-1,2-dicarboxylate;hydrochloride, 1-tert-Butyl 2-methyl (2R)-piperazine-1,2-dicarboxylate--hydrogen chloride (1/1)