(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine, 98%
cas: 1041434-65-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine, 98% (CAS 1041434-65-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Ambeed, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1232595-250mg |
| cas | 1041434-65-4 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 1132,44 Pln | |
| Ambeed | 1g | 2222,69 Pln | |
| Ambeed | 5g | 7774,06 Pln | |
| BLDpharm | 100mg | 819,74 Pln | |
| BLDpharm | 250mg | 1219,60 Pln | |
| BLDpharm | 1g | 2391,40 Pln | |
| BLDpharm | 5g | 8378,19 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
3,3'-spirobi[1,2-dihydroindene]-4,4'-diamine (CAS 1041434-65-4) to związek chemiczny o wzorze sumarycznym C17H18N2 i masie molowej 250.34 g/mol. Nazwa systematyczna IUPAC: 3,3'-spirobi[1,2-dihydroindene]-4,4'-diamine. InChIKey: LXEAIMHQRXRIGO-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H18N2 |
|---|---|
| Masa molowa | 250.34 g/mol |
| Nazwa IUPAC | 3,3'-spirobi[1,2-dihydroindene]-4,4'-diamine |
| InChIKey | LXEAIMHQRXRIGO-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC3=C2C(=CC=C3)N)C4=C1C=CC=C4N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine, (S)-1,1'-Spirobiindane-7,7'-diamine, (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine, (1S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine, (1R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine, 2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine, (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine, (S)-2,2'',3,3''-Tetrahydro-1,1''-spirobi[1H-indene]-7,7''-diamine, (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine, 98%, (99% ee), (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine, 98%, (99% ee)