cas: 312624-65-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2,4-dimethylpentanoic acid, 98%, 98% (CAS 312624-65-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11C46X-100mg |
| cas | 312624-65-0 |
| opakowanie | 100mg |
| dostępność | 1000g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 88,40 Pln | |
| Chemat | 250mg | 107,60 Pln | |
| Chemat | 1g | 198,80 Pln | |
| Chemat | 5g | 578,00 Pln | |
| Chemat | 10g | 890,00 Pln | |
| Chemat | 25g | 1648,40 Pln | |
| Chemat | 50g | 2886,80 Pln | |
| Chemat | 250g | 3746,00 Pln | |
| Chemat | 500g | 6475,20 Pln | |
| Chemat | 1kg | 12357,20 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,4-dimethylpentanoic acid (CAS 312624-65-0) to związek chemiczny o wzorze sumarycznym C22H25NO4 i masie molowej 367.4 g/mol. Nazwa systematyczna IUPAC: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,4-dimethylpentanoic acid. InChIKey: LKQDQIGTIVQHMG-QFIPXVFZSA-N.
| Wzór sumaryczny | C22H25NO4 |
|---|---|
| Masa molowa | 367.4 g/mol |
| Nazwa IUPAC | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2,4-dimethylpentanoic acid |
| InChIKey | LKQDQIGTIVQHMG-QFIPXVFZSA-N |
| SMILES | CC(C)C[C@@](C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Dane obliczone przez PubChem (NCBI)