cas: 959578-11-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpentanoic acid, 98%, 98% (CAS 959578-11-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11H784-100mg |
| cas | 959578-11-1 |
| opakowanie | 100mg |
| dostępność | 250g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 122,00 Pln | |
| Chemat | 250mg | 160,40 Pln | |
| Chemat | 500mg | 261,20 Pln | |
| Chemat | 1g | 338,00 Pln | |
| Chemat | 5g | 750,80 Pln | |
| Chemat | 10g | 1302,80 Pln | |
| Chemat | 25g | 2613,20 Pln | |
| Chemat | 50g | 3006,80 Pln | |
| Chemat | 100g | 5589,20 Pln | |
| Chemat | 250g | 11128,40 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid (CAS 959578-11-1) to związek chemiczny o wzorze sumarycznym C26H25NO4 i masie molowej 415.5 g/mol. Nazwa systematyczna IUPAC: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid. InChIKey: JDBKBGOHVBNXRB-DEOSSOPVSA-N.
| Wzór sumaryczny | C26H25NO4 |
|---|---|
| Masa molowa | 415.5 g/mol |
| Nazwa IUPAC | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid |
| InChIKey | JDBKBGOHVBNXRB-DEOSSOPVSA-N |
| SMILES | C1=CC=C(C=C1)CCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Dane obliczone przez PubChem (NCBI)