(S)-2-(Fmoc-amino)-4-ethyl-hexanoic acid, 98%
cas: 1998613-43-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-2-(Fmoc-amino)-4-ethyl-hexanoic acid, 98% (CAS 1998613-43-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12JMEK-50mg |
| cas | 1998613-43-6 |
| opakowanie | 50mg |
| dostępność | 15g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 280,40 Pln | |
| Chemat | 100mg | 342,80 Pln | |
| Chemat | 250mg | 621,20 Pln | |
| Chemat | 1g | 1720,40 Pln | |
| Chemat | 5g | 5618,00 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-4-ethyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1998613-43-6) to związek chemiczny o wzorze sumarycznym C23H27NO4 i masie molowej 381.5 g/mol. Nazwa systematyczna IUPAC: (2S)-4-ethyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: XJEVIPVJYGAMKH-NRFANRHFSA-N.
| Wzór sumaryczny | C23H27NO4 |
|---|---|
| Masa molowa | 381.5 g/mol |
| Nazwa IUPAC | (2S)-4-ethyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | XJEVIPVJYGAMKH-NRFANRHFSA-N |
| SMILES | CCC(CC)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(S)-2-(Fmoc-amino)-4-ethyl-hexanoic acid, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-ethylhexanoic acid, (S)-2-(Fmoc-amino)-4-ethyl-hexanoic acid, (2S)-4-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid, (2S)-4-ethyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid, (S)-2-(((9H-fluoren-9-yl)methoxy)carbonylamino)-4-ethylhexanoic acid, (S)-2-(Fmoc-amino)-4-ethyl-hexanoicacid, (S)-2-(Fmoc-amino)-4-ethylhexanoic Acid, L-Norleucine, 4-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-