(S)-2-Amino-3-(2-nitrophenyl)propanoic acid, 95%, 95%
cas: 19883-75-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-2-Amino-3-(2-nitrophenyl)propanoic acid, 95%, 95% (CAS 19883-75-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch113BRK-10g |
| cas | 19883-75-1 |
| opakowanie | 10g |
| dostępność | 200g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 10g | 794,00 Pln | |
| Chemat | 25g | 1821,20 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-2-amino-3-(2-nitrophenyl)propanoic acid (CAS 19883-75-1) to związek chemiczny o wzorze sumarycznym C9H10N2O4 i masie molowej 210.19 g/mol. Nazwa systematyczna IUPAC: (2S)-2-amino-3-(2-nitrophenyl)propanoic acid. InChIKey: SDZGVFSSLGTJAJ-ZETCQYMHSA-N.
| Wzór sumaryczny | C9H10N2O4 |
|---|---|
| Masa molowa | 210.19 g/mol |
| Nazwa IUPAC | (2S)-2-amino-3-(2-nitrophenyl)propanoic acid |
| InChIKey | SDZGVFSSLGTJAJ-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)N)[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(2S)-2-amino-3-(2-nitrophenyl)propanoic acid, L-2-Nitrophenylalanine, (S)-2-amino-3-(2-nitrophenyl)propanoic acid, 2-Nitro-L-phenylalanine, L-Phenylalanine, 2-nitro-, L-2-Nitrophe, L-3-(o-Nitrophenyl)-alanine; L-2-Nitrophenylalanine; NSC 21949;, o-nitrophenylalanine, 2-Nitrophenylalanine, L-, (S)-2-Amino-3-(2-nitrophenyl)propanoicacid