(S)-2-Amino-3-(thiophen-2-yl)propanoic acid, 97%, 97%
cas: 22951-96-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-2-Amino-3-(thiophen-2-yl)propanoic acid, 97%, 97% (CAS 22951-96-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch113LOH-250mg |
| cas | 22951-96-8 |
| opakowanie | 250mg |
| dostępność | 500g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 83,60 Pln | |
| Chemat | 1g | 131,60 Pln | |
| Chemat | 5g | 309,20 Pln | |
| Chemat | 100g | 4864,40 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-2-amino-3-thiophen-2-ylpropanoic acid (CAS 22951-96-8) to związek chemiczny o wzorze sumarycznym C7H9NO2S i masie molowej 171.22 g/mol. Nazwa systematyczna IUPAC: (2S)-2-amino-3-thiophen-2-ylpropanoic acid. InChIKey: WTOFYLAWDLQMBZ-LURJTMIESA-N.
| Wzór sumaryczny | C7H9NO2S |
|---|---|
| Masa molowa | 171.22 g/mol |
| Nazwa IUPAC | (2S)-2-amino-3-thiophen-2-ylpropanoic acid |
| InChIKey | WTOFYLAWDLQMBZ-LURJTMIESA-N |
| SMILES | C1=CSC(=C1)C[C@@H](C(=O)O)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3-(2-Thienyl)-L-alanine, L-3-(2-Thienyl)alanine, beta-2-thienyl-l-alanine, beta-(2-THIENYL)-L-ALANINE, 2-Thiophenepropanoic acid, alpha-amino-, (alphaS)-, (2S)-2-amino-3-(thiophen-2-yl)propanoic acid, 3-Thiophenepropanoic acid, alpha-amino-, 3-(2-thienyl)alanine, (S)-2-amino-3-(thiophen-2-yl)propanoic acid, L-2-Thienylalanine