(S)-2-Amino-6-(trimethylammonio)hexanoate, 95%
cas: 23284-33-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-2-Amino-6-(trimethylammonio)hexanoate, 95% (CAS 23284-33-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 10mg, 25mg, 50mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A520674-100mg |
| cas | 23284-33-5 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 2990,31 Pln | |
| Ambeed | 250mg | 5899,50 Pln | |
| Chemat | 10mg | 578,00 Pln | |
| Chemat | 25mg | 1096,40 Pln | |
| Chemat | 50mg | 1610,00 Pln | |
| Chemat | 100mg | 2387,60 Pln | |
| Chemat | 250mg | 4706,00 Pln | |
| BLDpharm | 10mg | 708,66 Pln | |
| BLDpharm | 25mg | 1336,22 Pln | |
| BLDpharm | 50mg | 1974,88 Pln | |
| BLDpharm | 100mg | 2930,10 Pln | |
| BLDpharm | 250mg | 5790,21 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
(2S)-2-amino-6-(trimethylazaniumyl)hexanoate (CAS 23284-33-5) to związek chemiczny o wzorze sumarycznym C9H20N2O2 i masie molowej 188.27 g/mol. Nazwa systematyczna IUPAC: (2S)-2-amino-6-(trimethylazaniumyl)hexanoate. InChIKey: MXNRLFUSFKVQSK-QMMMGPOBSA-N.
| Wzór sumaryczny | C9H20N2O2 |
|---|---|
| Masa molowa | 188.27 g/mol |
| Nazwa IUPAC | (2S)-2-amino-6-(trimethylazaniumyl)hexanoate |
| InChIKey | MXNRLFUSFKVQSK-QMMMGPOBSA-N |
| SMILES | C[N+](C)(C)CCCC[C@@H](C(=O)[O-])N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
N-6-Trimethyllysine, (S)-2-amino-6-(trimethylammonio)hexanoate, N6,N6,N6-Trimethyl-L-lysine, (2S)-2-amino-6-(trimethylazaniumyl)hexanoate, N-EPSILON,N-EPSILON,N-EPSILON-TRIMETHYLLYSINE, (S)-2-amino-6-(trimethylammonio)hexanoic acid, delta-trimethyllysine, Nepsilon,Nepsilon,Nepsilon-Trimethyllysine, S)-5-amino-5-carboxy-N,N,N-trimethyl-1-pentanaminium