(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(thiophen-2-yl)propanoic acid, 95%
cas: 507472-08-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(thiophen-2-yl)propanoic acid, 95% (CAS 507472-08-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: BLDpharm.
| producent | BLDpharm |
|---|---|
| nr katalogowy | BD130769-100mg |
| cas | 507472-08-4 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| BLDpharm | 100mg | 308,80 Pln | |
| BLDpharm | 250mg | 469,86 Pln | |
| BLDpharm | 1g | 1141,84 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3-4 tygodnie |
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid (CAS 507472-08-4) to związek chemiczny o wzorze sumarycznym C22H19NO4S i masie molowej 393.5 g/mol. Nazwa systematyczna IUPAC: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid. InChIKey: OTFVOIGWAZDVSI-IBGZPJMESA-N.
| Wzór sumaryczny | C22H19NO4S |
|---|---|
| Masa molowa | 393.5 g/mol |
| Nazwa IUPAC | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid |
| InChIKey | OTFVOIGWAZDVSI-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)O)C4=CC=CS4 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Fmoc-(S)-3-Amino-3-(2-thienyl)-propionic acid, (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid, (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-thienyl)propanoic acid, Fmoc-D-|A-Ala-(2-thienyl)-OH, (S)-3-(Fmoc-amino)-3-(2-thienyl)propanoic Acid, (S)-3-(Fmoc-amino)-3-(thiophen-2-yl)propanoic Acid, (betaS)-beta-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-thiophenepropanoic acid
