cas: 1217740-02-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-Lercanidipine D3 hydrochloride (CAS 1217740-02-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg. Oferty producentów: TargetMol.
| producent | TargetMol |
|---|---|
| nr katalogowy | T12803-1mg |
| cas | 1217740-02-7 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 3254,94 Pln | |
| TargetMol | 5mg | 9344,68 Pln | |
| TargetMol | 10mg | 15467,41 Pln | |
| TargetMol | 25mg | 28523,41 Pln |
| czystość | No data |
|---|---|
| czas dostawy | ok. 33 dni |
5-O-[1-[3,3-diphenylpropyl(trideuteriomethyl)amino]-2-methylpropan-2-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (CAS 1217740-02-7) to związek chemiczny o wzorze sumarycznym C36H42ClN3O6 i masie molowej 651.2 g/mol. Nazwa systematyczna IUPAC: 5-O-[1-[3,3-diphenylpropyl(trideuteriomethyl)amino]-2-methylpropan-2-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride. InChIKey: WMFYOYKPJLRMJI-RFTUCFSWSA-N.
| Wzór sumaryczny | C36H42ClN3O6 |
|---|---|
| Masa molowa | 651.2 g/mol |
| Nazwa IUPAC | 5-O-[1-[3,3-diphenylpropyl(trideuteriomethyl)amino]-2-methylpropan-2-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| InChIKey | WMFYOYKPJLRMJI-RFTUCFSWSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC(C1=CC=CC=C1)C2=CC=CC=C2)CC(C)(C)OC(=O)C3=C(NC(=C([C@@H]3C4=CC(=CC=C4)[N+](=O)[O-])C(=O)OC)C)C.Cl |
Dane obliczone przez PubChem (NCBI)