cas: 585-84-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(Z)-Aconitic acid, 99.28% (CAS 585-84-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 5 mg, 10 mg, 100 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-W016814-10mM/1mL |
| cas | 585-84-2 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 384,71 Pln | |
| MedChemExpress | 5 mg | 361,49 Pln | |
| MedChemExpress | 10 mg | 454,37 Pln | |
| MedChemExpress | 100 mg | 1058,09 Pln | |
| MedChemExpress | 50 mg | 793,38 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.28% |
(Z)-prop-1-ene-1,2,3-tricarboxylic acid (CAS 585-84-2) to związek chemiczny o wzorze sumarycznym C6H6O6 i masie molowej 174.11 g/mol. Nazwa systematyczna IUPAC: (Z)-prop-1-ene-1,2,3-tricarboxylic acid. InChIKey: GTZCVFVGUGFEME-IWQZZHSRSA-N.
| Wzór sumaryczny | C6H6O6 |
|---|---|
| Masa molowa | 174.11 g/mol |
| Nazwa IUPAC | (Z)-prop-1-ene-1,2,3-tricarboxylic acid |
| InChIKey | GTZCVFVGUGFEME-IWQZZHSRSA-N |
| SMILES | C(/C(=C/C(=O)O)/C(=O)O)C(=O)O |
Dane obliczone przez PubChem (NCBI)