cas: 291756-76-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(Z)-N-[2-Chloro-3-(dimethylamino)allylidene]-N-methylmethanaminium Hexafluorophosphate, 98%, 98% (CAS 291756-76-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 10g, 25g, 100g, 500g, 1kg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch113XKJ-5g |
| cas | 291756-76-8 |
| opakowanie | 5g |
| dostępność | 8000g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 5g | 69,20 Pln | |
| Chemat | 10g | 74,00 Pln | |
| Chemat | 25g | 78,80 Pln | |
| Chemat | 100g | 112,40 Pln | |
| Chemat | 500g | 398,40 Pln | |
| Chemat | 1kg | 717,20 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
[(Z)-2-chloro-3-(dimethylamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate (CAS 291756-76-8) to związek chemiczny o wzorze sumarycznym C7H14ClF6N2P i masie molowej 306.62 g/mol. Nazwa systematyczna IUPAC: [(Z)-2-chloro-3-(dimethylamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate. InChIKey: PIUHAULDXSPPQV-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H14ClF6N2P |
|---|---|
| Masa molowa | 306.62 g/mol |
| Nazwa IUPAC | [(Z)-2-chloro-3-(dimethylamino)prop-2-enylidene]-dimethylazanium hexafluorophosphate |
| InChIKey | PIUHAULDXSPPQV-UHFFFAOYSA-N |
| SMILES | CN(C)/C=C(/C=[N+](C)C)\Cl.F[P-](F)(F)(F)(F)F |
Dane obliczone przez PubChem (NCBI)