(rel)-Eglumegad, 97.0%
cas: 176027-90-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(rel)-Eglumegad, 97.0% (CAS 176027-90-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 25 mg, 5 mg, 100 mg, 50 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-18941B-10 mg |
| cas | 176027-90-0 |
| opakowanie | 10 mg |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 1053,44 Pln | |
| MedChemExpress | 25 mg | 1982,24 Pln | |
| MedChemExpress | 5 mg | 695,86 Pln | |
| MedChemExpress | 100 mg | 4917,25 Pln | |
| MedChemExpress | 50 mg | 3096,80 Pln | |
| MedChemExpress | 10mM/1mL | 751,58 Pln |
właściwości
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 97.0% |
(1S,2S,5R,6S)-2-aminobicyclo[3.1.0]hexane-2,6-dicarboxylic acid (CAS 176027-90-0) to związek chemiczny o wzorze sumarycznym C8H11NO4 i masie molowej 185.18 g/mol. Nazwa systematyczna IUPAC: (1S,2S,5R,6S)-2-aminobicyclo[3.1.0]hexane-2,6-dicarboxylic acid. InChIKey: VTAARTQTOOYTES-RGDLXGNYSA-N.
| Wzór sumaryczny | C8H11NO4 |
|---|---|
| Masa molowa | 185.18 g/mol |
| Nazwa IUPAC | (1S,2S,5R,6S)-2-aminobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| InChIKey | VTAARTQTOOYTES-RGDLXGNYSA-N |
| SMILES | C1C[C@]([C@H]2[C@@H]1[C@@H]2C(=O)O)(C(=O)O)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Eglumegad, (+)-2-Aminobicyclo(3.1.0)hexane-2,6-dicarboxylic acid, Eglumetad, (1S,2S,5R,6S)-2-aminobicyclo[3.1.0]hexane-2,6-dicarboxylic acid, (rel)-Eglumegad, Eglumetad anhydrous, (1S,2S,5R,6S)-2-Aminobicyclo(3.1.0)hexane-2,6-dicarboxylic acid, Bicyclo[3.1.0]hexane-2,6-dicarboxylic acid, 2-amino-, (1S,2S,5R,6S)-, (1S,2S,5R,6S)-2-Amino-bicyclo[3.1.0]hexane-2,6-dicarboxylic acid, (1S,2S,5R,6S)-2-aminobicyclo[3.1.0]hexane-2,6-dicarboxylicacid