[1，1'-Binaphthalen]-4-ylboronic acid, 98%, 98%
cas: 363607-69-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
[1，1'-Binaphthalen]-4-ylboronic acid, 98%, 98% (CAS 363607-69-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch118A4X-100mg |
| cas | 363607-69-6 |
| opakowanie | 100mg |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 83,60 Pln | |
| Chemat | 250mg | 107,60 Pln | |
| Chemat | 1g | 174,80 Pln | |
| Chemat | 5g | 515,60 Pln | |
| Chemat | 10g | 741,20 Pln | |
| Chemat | 25g | 1475,60 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(4-naphthalen-1-ylnaphthalen-1-yl)boronic acid (CAS 363607-69-6) to związek chemiczny o wzorze sumarycznym C20H15BO2 i masie molowej 298.1 g/mol. Nazwa systematyczna IUPAC: (4-naphthalen-1-ylnaphthalen-1-yl)boronic acid. InChIKey: GKRWMBPEFXXULT-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H15BO2 |
|---|---|
| Masa molowa | 298.1 g/mol |
| Nazwa IUPAC | (4-naphthalen-1-ylnaphthalen-1-yl)boronic acid |
| InChIKey | GKRWMBPEFXXULT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=CC=C12)C3=CC=CC4=CC=CC=C43)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
[1,1'-Binaphthalen]-4-ylboronic Acid (contains varying amounts of Anhydride), (1,1'-Binaphthalen)-4-ylboronic Acid (contains varying amounts of Anhydride), [1,1'-Binaphthalen]-4-ylboronic acid, (4-naphthalen-1-ylnaphthalen-1-yl)boronic acid, 4-(1-Naphthyl)naphthalene-1-boronic acid, [1,1'-Binaphthalen]-4-ylboronicacid, 4-(naphthalene-1-yl)-1-naphthalene boronic acid, 1,1'-binaphthyl-4-ylboronic acid, [11'-Binaphthalen]-4-ylboronic acid, 4-(1-Naphthyl)-1-Naphthylboronic acid