[4-(3-Methylphenyl)phenyl]acetic acid, 98%, 98%
cas: 296777-83-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
[4-(3-Methylphenyl)phenyl]acetic acid, 98%, 98% (CAS 296777-83-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch113Z3N-100mg |
| cas | 296777-83-8 |
| opakowanie | 100mg |
| dostępność | 3g |
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 179,60 Pln | |
| Chemat | 250mg | 227,60 Pln | |
| Chemat | 1g | 510,80 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
2-[4-(3-methylphenyl)phenyl]acetic acid (CAS 296777-83-8) to związek chemiczny o wzorze sumarycznym C15H14O2 i masie molowej 226.27 g/mol. Nazwa systematyczna IUPAC: 2-[4-(3-methylphenyl)phenyl]acetic acid. InChIKey: ABKKNUMOLNPQHN-UHFFFAOYSA-N.
| Wzór sumaryczny | C15H14O2 |
|---|---|
| Masa molowa | 226.27 g/mol |
| Nazwa IUPAC | 2-[4-(3-methylphenyl)phenyl]acetic acid |
| InChIKey | ABKKNUMOLNPQHN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=C(C=C2)CC(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
[4-(3-Methylphenyl)phenyl]acetic acid, 2-(3'-Methyl-[1,1'-biphenyl]-4-yl)acetic acid, 2-[4-(3-methylphenyl)phenyl]acetic acid, 3'-Methyl-biphenyl-4-acetic acid, [1,1'-Biphenyl]-4-acetic acid, 3'-methyl-, 2-(3'-Methyl-[1,1'-biphenyl]-4-yl)aceticacid, 2-[4-(m-tolyl)phenyl]acetic acid, 3'-Methyl[1,1'-biphenyl]-4-acetic acid, 1,1'-Biphenyl]-4-acetic acid, 3'-methyl-, 3'-methyl-(1,1'-biphenylyl)-4-acetic acid