chemat product 132605-95-9 (R)-2-(Aminomethyl)-4-methylpentanoic acid hydrochloride, 95%

(R)-2-(Aminomethyl)-4-methylpentanoic acid hydrochloride, 95% cas: (132605-95-9)

nazwa: (R)-2-(Aminomethyl)-4-methylpentanoic acid hydrochloride, 95%

nr katalogowy: QV-0115-1g

cas: 132605-95-9

producent: Combi-blocks

opakowanie: 1g

cena: 00,00 [Pln] (bez rabatu)

wyszukaj podobne produkty: 132605-95-9


szczegóły:

Smiles: Cl.CC(C)C[C@H](CN)C(=O)O. Formula: C7H15NO2.ClH. Formula weight: 181.7.

właściwości

czystość: 95%

czas dostawy: 07.11.2025 - tylko jeżeli na stocku, by sprawdzić kliknij dostępność

msds