1,1'-(1,4-Phenylene)bis(thiourea), 97%
cas: 1519-70-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,1'-(1,4-Phenylene)bis(thiourea), 97% (CAS 1519-70-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: AmBeed, BLDpharm.
| producent | AmBeed |
|---|---|
| nr katalogowy | A434242-100mg |
| cas | 1519-70-6 |
| opakowanie | 100mg |
| dostępność | Global Stock: 24.829g |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| AmBeed | 100mg | 132,50 Pln | |
| Ambeed | 250mg | 197,94 Pln | |
| Ambeed | 1g | 231,31 Pln | |
| Ambeed | 5g | 676,31 Pln | |
| Ambeed | 10g | 1260,38 Pln | |
| Ambeed | 25g | 2372,88 Pln | |
| BLDpharm | 250mg | 181,07 Pln | |
| BLDpharm | 1g | 247,72 Pln | |
| BLDpharm | 5g | 725,32 Pln | |
| BLDpharm | 10g | 1352,88 Pln | |
| BLDpharm | 25g | 2552,46 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie, tylko jeżeli na stocku, by sprawdzić kliknij dostępność |
[4-(carbamothioylamino)phenyl]thiourea (CAS 1519-70-6) to związek chemiczny o wzorze sumarycznym C8H10N4S2 i masie molowej 226.3 g/mol. Nazwa systematyczna IUPAC: [4-(carbamothioylamino)phenyl]thiourea. InChIKey: AMNPXXIGUOKIPP-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H10N4S2 |
|---|---|
| Masa molowa | 226.3 g/mol |
| Nazwa IUPAC | [4-(carbamothioylamino)phenyl]thiourea |
| InChIKey | AMNPXXIGUOKIPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=S)N)NC(=S)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Urea, 1,1'-p-phenylenebis(2-thio-, N,N''-1,4-Phenylenebis(thiourea), N,N''-1,4-Phenylenebis[thiourea], [4-(carbamothioylamino)phenyl]thiourea, 1,4-Phenylenebis(2-thiourea), 1,1'-(1,4-Phenylene)bis(thiourea), 1,1'-p-Phenylenebis(2-thiourea), 1,1'-benzene-1,4-diylbis(thiourea), Thiourea, N,N''-1,4-phenylenebis-, phenylenethiourea