1,1'-(5-Amino-1,3-phenylene)diethanone, 97%
cas: 87533-49-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,1'-(5-Amino-1,3-phenylene)diethanone, 97% (CAS 87533-49-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A631115-100mg |
| cas | 87533-49-1 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 604,00 Pln | |
| Ambeed | 250mg | 1021,19 Pln | |
| Ambeed | 1g | 2817,88 Pln | |
| Ambeed | 5g | 9687,56 Pln | |
| Ambeed | 10g | 15455,88 Pln | |
| Chemat | 100mg | 472,40 Pln | |
| Chemat | 250mg | 813,20 Pln | |
| Chemat | 1g | 2094,80 Pln | |
| Chemat | 5g | 9918,80 Pln | |
| BLDpharm | 100mg | 647,57 Pln | |
| BLDpharm | 250mg | 1097,42 Pln | |
| BLDpharm | 1g | 3030,07 Pln | |
| BLDpharm | 5g | 10438,57 Pln | |
| BLDpharm | 10g | 16664,16 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 2-3 tygodnie |
1-(3-acetyl-5-aminophenyl)ethanone (CAS 87533-49-1) to związek chemiczny o wzorze sumarycznym C10H11NO2 i masie molowej 177.20 g/mol. Nazwa systematyczna IUPAC: 1-(3-acetyl-5-aminophenyl)ethanone. InChIKey: XUVYQFMQZZYSLO-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H11NO2 |
|---|---|
| Masa molowa | 177.20 g/mol |
| Nazwa IUPAC | 1-(3-acetyl-5-aminophenyl)ethanone |
| InChIKey | XUVYQFMQZZYSLO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)N)C(=O)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Cni H1894, 1-(3-acetyl-5-aminophenyl)ethan-1-one, 3,5-Diacetylaniline, Ethanone, 1,1'-(5-amino-1,3-phenylene)bis-, 1-(3-acetyl-5-aminophenyl)ethanone, 1,1'-(5-Amino-1,3-phenylene)diethanone, 1,1'-(5-Amino-1,3-phenylene)bis(ethan-1-one), 1-(3-acetyl-5-amino-phenyl)ethanone, XUVYQFMQZZYSLO-UHFFFAOYSA-N, 1,1'-(5-Amino-1,3-phenylene)di(ethan-1-one)
