1,1,1,3,3,3-Hexaethenyldisiloxane, 95%
cas: 75144-60-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1,1,1,3,3,3-Hexaethenyldisiloxane, 95% (CAS 75144-60-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 200mg, 250mg, 1g, 5g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch116QIN-200mg |
| cas | 75144-60-4 |
| opakowanie | 200mg |
| dostępność | 200g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 200mg | 170,00 Pln | |
| Chemat | 250mg | 184,40 Pln | |
| Chemat | 1g | 395,60 Pln | |
| Chemat | 5g | 1403,60 Pln | |
| Chemat | 25g | 5819,60 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
Tris(ethenyl)-tris(ethenyl)silyloxysilane (CAS 75144-60-4) to związek chemiczny o wzorze sumarycznym C12H18OSi2 i masie molowej 234.44 g/mol. Nazwa systematyczna IUPAC: tris(ethenyl)-tris(ethenyl)silyloxysilane. InChIKey: IGJPWUZGPMLVDT-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H18OSi2 |
|---|---|
| Masa molowa | 234.44 g/mol |
| Nazwa IUPAC | tris(ethenyl)-tris(ethenyl)silyloxysilane |
| InChIKey | IGJPWUZGPMLVDT-UHFFFAOYSA-N |
| SMILES | C=C[Si](C=C)(C=C)O[Si](C=C)(C=C)C=C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
HEXAVINYLDISILOXANE, tris(ethenyl)-tris(ethenyl)silyloxysilane, Disiloxane,1,1,1,3,3,3-hexaethenyl-, 1,1,1,3,3,3-hexavinyldisiloxane, 1,1,1,3,3,3-Hexaethenyldisiloxane, triethenyl[(triethenylsilyl)oxy]silane, Hexaethenyldisiloxane, C12H18OSi2, trivinylsilyloxy(trivinyl)silane, IGJPWUZGPMLVDT-UHFFFAOYSA-N